C12H17O8P — CID 102515083
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-methylphenoxy)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 102515083) has the molecular formula C12H17O8P and a molecular weight of 320.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-methylphenoxy)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-methylphenoxy)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 102515083 |
| Molecular Formula | C12H17O8P |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-methylphenoxy)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1ccc(O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C12H17O8P/c1-7-2-4-8(5-3-7)19-12-11(14)10(13)9(20-12)6-18-21(15,16)17/h2-5,9-14H,6H2,1H3,(H2,15,16,17)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | GMYKEMRLZZRUFT-KKOKHZNYSA-N |
| XLogP | -0.07 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|