C19H23O10P — CID 71488931
[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methoxymethyl dihydrogen phosphate (PubChem CID 71488931) has the molecular formula C19H23O10P and a molecular weight of 442.36 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methoxymethyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methoxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71488931 |
| Molecular Formula | C19H23O10P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methoxymethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCOC[C@H]1O[C@H](Oc2ccc(-c3ccccc3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23O10P/c20-16-15(10-26-11-27-30(23,24)25)29-19(18(22)17(16)21)28-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-22H,10-11H2,(H2,23,24,25)/t15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | ICMNTMIYFLVFKC-GFEQUFNTSA-N |
| XLogP | 0.62 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|