C18H23N2O9P — CID 132548375
diamino [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methyl phosphate (PubChem CID 132548375) has the molecular formula C18H23N2O9P and a molecular weight of 442.36 g/mol. Its IUPAC name is diamino [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methyl phosphate.
| Compound Name | diamino [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 132548375 |
| Molecular Formula | C18H23N2O9P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | diamino [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-phenylphenoxy)oxan-2-yl]methyl phosphate |
| SMILES | NOP(=O)(ON)OC[C@H]1O[C@H](Oc2ccc(-c3ccccc3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H23N2O9P/c19-28-30(24,29-20)25-10-14-15(21)16(22)17(23)18(27-14)26-13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14-18,21-23H,10,19-20H2/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | WOXCDDKBNNPVSX-ZBRFXRBCSA-N |
| XLogP | 0.45 |
| TPSA | 175.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|