C26H29O9P — CID 20688928
diphenyl [(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(2-phenylethoxy)oxan-2-yl]methyl phosphate (PubChem CID 20688928) has the molecular formula C26H29O9P and a molecular weight of 516.48 g/mol. Its IUPAC name is diphenyl [(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(2-phenylethoxy)oxan-2-yl]methyl phosphate.
| Compound Name | diphenyl [(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(2-phenylethoxy)oxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 20688928 |
| Molecular Formula | C26H29O9P |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | diphenyl [(2R,3S,4S,5S)-3,4,5-trihydroxy-6-(2-phenylethoxy)oxan-2-yl]methyl phosphate |
| SMILES | O=P(OC[C@H]1OC(OCCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H29O9P/c27-23-22(33-26(25(29)24(23)28)31-17-16-19-10-4-1-5-11-19)18-32-36(30,34-20-12-6-2-7-13-20)35-21-14-8-3-9-15-21/h1-15,22-29H,16-18H2/t22-,23-,24+,25+,26?/m1/s1 |
| InChIKey | WEHSYOXIGIRXAV-APQRZRNDSA-N |
| XLogP | 3.34 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|