C17H26O6 — CID 102065433
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(5-phenylpentoxy)oxane-3,4,5-triol (PubChem CID 102065433) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(5-phenylpentoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(5-phenylpentoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102065433 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(5-phenylpentoxy)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](OCCCCCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H26O6/c18-11-13-14(19)15(20)16(21)17(23-13)22-10-6-2-5-9-12-7-3-1-4-8-12/h1,3-4,7-8,13-21H,2,5-6,9-11H2/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | RDTNQDQALRQETG-UHDSXZAQSA-N |
| XLogP | 0.22 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|