C17H26O6S — CID 68537800
(2S,3R,4S,5S,6R)-2-(4-benzylsulfanylbutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 68537800) has the molecular formula C17H26O6S and a molecular weight of 358.46 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(4-benzylsulfanylbutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(4-benzylsulfanylbutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68537800 |
| Molecular Formula | C17H26O6S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(4-benzylsulfanylbutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](OCCCCSCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H26O6S/c18-10-13-14(19)15(20)16(21)17(23-13)22-8-4-5-9-24-11-12-6-2-1-3-7-12/h1-3,6-7,13-21H,4-5,8-11H2/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | SSWKPSOMFLPMIT-UUAJXVIYSA-N |
| XLogP | 0.52 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|