C16H23FO6 — CID 148709502
2-[4-(4-fluorophenyl)butoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 148709502) has the molecular formula C16H23FO6 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)butoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-(4-fluorophenyl)butoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 148709502 |
| Molecular Formula | C16H23FO6 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[4-(4-fluorophenyl)butoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1OC(OCCCCc2ccc(F)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C16H23FO6/c17-11-6-4-10(5-7-11)3-1-2-8-22-16-15(21)14(20)13(19)12(9-18)23-16/h4-7,12-16,18-21H,1-3,8-9H2 |
| InChIKey | NWYKCZZODUFYJY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|