C14H19FO5 — CID 175930590
(2R,3R,4S,5S,6R)-2-[2-(4-fluorophenyl)ethyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 175930590) has the molecular formula C14H19FO5 and a molecular weight of 286.30 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[2-(4-fluorophenyl)ethyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[2-(4-fluorophenyl)ethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 175930590 |
| Molecular Formula | C14H19FO5 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[2-(4-fluorophenyl)ethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](CCc2ccc(F)cc2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19FO5/c15-9-4-1-8(2-5-9)3-6-10-12(17)14(19)13(18)11(7-16)20-10/h1-2,4-5,10-14,16-19H,3,6-7H2/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | XTJUBYOCWPLNKM-RGDJUOJXSA-N |
| XLogP | -0.40 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |