C13H17FO6 — CID 70223591
(2S,3R,4S,5S,6R)-3-[(4-fluorophenyl)methoxy]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 70223591) has the molecular formula C13H17FO6 and a molecular weight of 288.27 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-3-[(4-fluorophenyl)methoxy]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-3-[(4-fluorophenyl)methoxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 70223591 |
| Molecular Formula | C13H17FO6 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2S,3R,4S,5S,6R)-3-[(4-fluorophenyl)methoxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@H](O)[C@H](OCc2ccc(F)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H17FO6/c14-8-3-1-7(2-4-8)6-19-12-11(17)10(16)9(5-15)20-13(12)18/h1-4,9-13,15-18H,5-6H2/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | POTVKFYOPMMJNC-LBELIVKGSA-N |
| XLogP | -0.86 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |