C8H15BrO6 — CID 67861357
(2R,3R,4S,5R,6R)-3-(2-bromoethoxy)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 67861357) has the molecular formula C8H15BrO6 and a molecular weight of 287.11 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-(2-bromoethoxy)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-3-(2-bromoethoxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 67861357 |
| Molecular Formula | C8H15BrO6 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-(2-bromoethoxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](OCCBr)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15BrO6/c9-1-2-14-7-6(12)5(11)4(3-10)15-8(7)13/h4-8,10-13H,1-3H2/t4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | KRRWAJALDAQAKL-DWOUCZDBSA-N |
| XLogP | -1.80 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|