C12H25NO6 — CID 100920244
(2S,3R,4S,5S,6R)-3-[2-(diethylamino)ethoxy]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 100920244) has the molecular formula C12H25NO6 and a molecular weight of 279.33 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-3-[2-(diethylamino)ethoxy]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-3-[2-(diethylamino)ethoxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 100920244 |
| Molecular Formula | C12H25NO6 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (2S,3R,4S,5S,6R)-3-[2-(diethylamino)ethoxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCN(CC)CCO[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C12H25NO6/c1-3-13(4-2)5-6-18-11-10(16)9(15)8(7-14)19-12(11)17/h8-12,14-17H,3-7H2,1-2H3/t8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | QIZQUEHFODOXAX-ZIQFBCGOSA-N |
| XLogP | -1.86 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |