C9H18O7 — CID 146628954
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxypropoxy)oxane-2,4,5-triol (PubChem CID 146628954) has the molecular formula C9H18O7 and a molecular weight of 238.24 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxypropoxy)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxypropoxy)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 146628954 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3-(2-hydroxypropoxy)oxane-2,4,5-triol |
| SMILES | CC(O)CO[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C9H18O7/c1-4(11)3-15-8-7(13)6(12)5(2-10)16-9(8)14/h4-14H,2-3H2,1H3/t4?,5-,6+,7+,8-,9-/m1/s1 |
| InChIKey | HFVRIRKKHLPESP-VGPGGAHRSA-N |
| XLogP | -2.82 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |