C21H42O9 — CID 67749729
(2R,3R,4S,5R,6R)-3-[3-(2-decoxyethoxy)-2-hydroxypropoxy]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 67749729) has the molecular formula C21H42O9 and a molecular weight of 438.56 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-[3-(2-decoxyethoxy)-2-hydroxypropoxy]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-3-[3-(2-decoxyethoxy)-2-hydroxypropoxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 67749729 |
| Molecular Formula | C21H42O9 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-[3-(2-decoxyethoxy)-2-hydroxypropoxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCCCCCCCCCOCCOCC(O)CO[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C21H42O9/c1-2-3-4-5-6-7-8-9-10-27-11-12-28-14-16(23)15-29-20-19(25)18(24)17(13-22)30-21(20)26/h16-26H,2-15H2,1H3/t16?,17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | GHFRYKHPOOGVDH-QDHPPPJYSA-N |
| XLogP | 0.34 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|