C16H32O8 — CID 57001964
(2S,3R,4S,5R,6R)-2-(3-heptoxy-2-hydroxypropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 57001964) has the molecular formula C16H32O8 and a molecular weight of 352.42 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(3-heptoxy-2-hydroxypropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-(3-heptoxy-2-hydroxypropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 57001964 |
| Molecular Formula | C16H32O8 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(3-heptoxy-2-hydroxypropoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCOCC(O)CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H32O8/c1-2-3-4-5-6-7-22-9-11(18)10-23-16-15(21)14(20)13(19)12(8-17)24-16/h11-21H,2-10H2,1H3/t11?,12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | SYAGXKHAZQWGMI-YXPYLGEYSA-N |
| XLogP | -0.85 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|