C13H26O7 — CID 70127201
(2S,3R,4S,5S,6R)-2-(2-hydroxyheptoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70127201) has the molecular formula C13H26O7 and a molecular weight of 294.34 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(2-hydroxyheptoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(2-hydroxyheptoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70127201 |
| Molecular Formula | C13H26O7 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2-hydroxyheptoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCC(O)CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H26O7/c1-2-3-4-5-8(15)7-19-13-12(18)11(17)10(16)9(6-14)20-13/h8-18H,2-7H2,1H3/t8?,9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | DPKJHEXWAXXROU-NSIFWNNTSA-N |
| XLogP | -1.26 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|