C8H17NO6 — CID 87949821
(2R,3R,4S,5S)-3-(dimethylaminooxy)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 87949821) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is (2R,3R,4S,5S)-3-(dimethylaminooxy)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-3-(dimethylaminooxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 87949821 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2R,3R,4S,5S)-3-(dimethylaminooxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CN(C)O[C@@H]1[C@@H](O)[C@H](O)C(CO)O[C@H]1O |
| InChI | InChI=1S/C8H17NO6/c1-9(2)15-7-6(12)5(11)4(3-10)14-8(7)13/h4-8,10-13H,3H2,1-2H3/t4?,5-,6+,7-,8-/m1/s1 |
| InChIKey | RIOUOLNFMPEQRV-DRIAHNDOSA-N |
| XLogP | -2.72 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|