C6H14O6Si — CID 173027659
(3S,4S,5S,6R)-6-(hydroxymethyl)-3-silyloxyoxane-2,4,5-triol (PubChem CID 173027659) has the molecular formula C6H14O6Si and a molecular weight of 210.26 g/mol. Its IUPAC name is (3S,4S,5S,6R)-6-(hydroxymethyl)-3-silyloxyoxane-2,4,5-triol.
| Compound Name | (3S,4S,5S,6R)-6-(hydroxymethyl)-3-silyloxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 173027659 |
| Molecular Formula | C6H14O6Si |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (3S,4S,5S,6R)-6-(hydroxymethyl)-3-silyloxyoxane-2,4,5-triol |
| SMILES | OC[C@H]1OC(O)[C@@H](O[SiH3])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14O6Si/c7-1-2-3(8)4(9)5(12-13)6(10)11-2/h2-10H,1H2,13H3/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | DHLFBHSLTXMZME-QTVWNMPRSA-N |
| XLogP | -3.92 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|