C4H8O4 — CID 130341188
(2S)-4-(hydroxymethyl)oxetane-2,3-diol (PubChem CID 130341188) has the molecular formula C4H8O4 and a molecular weight of 120.10 g/mol. Its IUPAC name is (2S)-4-(hydroxymethyl)oxetane-2,3-diol.
| Compound Name | (2S)-4-(hydroxymethyl)oxetane-2,3-diol |
|---|---|
| PubChem CID | 130341188 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | (2S)-4-(hydroxymethyl)oxetane-2,3-diol |
| SMILES | OCC1O[C@H](O)C1O |
| InChI | InChI=1S/C4H8O4/c5-1-2-3(6)4(7)8-2/h2-7H,1H2/t2?,3?,4-/m0/s1 |
| InChIKey | WGBICNJMHDVHJB-LKHOQCSESA-N |
| XLogP | -1.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |