C10H20O7 — CID 69196037
(3R,4S,5S,6R)-3-(4-hydroxybutoxy)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 69196037) has the molecular formula C10H20O7 and a molecular weight of 252.26 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3-(4-hydroxybutoxy)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-3-(4-hydroxybutoxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 69196037 |
| Molecular Formula | C10H20O7 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (3R,4S,5S,6R)-3-(4-hydroxybutoxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | OCCCCO[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20O7/c11-3-1-2-4-16-9-8(14)7(13)6(5-12)17-10(9)15/h6-15H,1-5H2/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | HCHLVQYCNCNDIG-ZKZCYXTQSA-N |
| XLogP | -2.42 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|