C24H29F3O7 — CID 147053795
2-(hydroxymethyl)-6-[4-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]butoxy]oxane-3,4,5-triol (PubChem CID 147053795) has the molecular formula C24H29F3O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[4-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]butoxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[4-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]butoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 147053795 |
| Molecular Formula | C24H29F3O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-(hydroxymethyl)-6-[4-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]butoxy]oxane-3,4,5-triol |
| SMILES | OCC1OC(OCCCCc2ccc(OCc3cccc(C(F)(F)F)c3)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C24H29F3O7/c25-24(26,27)17-6-3-5-16(12-17)14-33-18-9-7-15(8-10-18)4-1-2-11-32-23-22(31)21(30)20(29)19(13-28)34-23/h3,5-10,12,19-23,28-31H,1-2,4,11,13-14H2 |
| InChIKey | BBVLYGXRFAQGHT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|