C12H22O8S — CID 59445347
3-[3-[(4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylsulfanyl]propanoic acid (PubChem CID 59445347) has the molecular formula C12H22O8S and a molecular weight of 326.37 g/mol. Its IUPAC name is 3-[3-[(4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylsulfanyl]propanoic acid.
| Compound Name | 3-[3-[(4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 59445347 |
| Molecular Formula | C12H22O8S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[3-[(4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCCCOC1OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C12H22O8S/c13-6-7-9(16)10(17)11(18)12(20-7)19-3-1-4-21-5-2-8(14)15/h7,9-13,16-18H,1-6H2,(H,14,15)/t7?,9-,10-,11?,12?/m0/s1 |
| InChIKey | ODTYSNDOXJJIIY-YDTVJASFSA-N |
| XLogP | -1.60 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|