C10H18O8 — CID 118348546
4-[(2R,3S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid (PubChem CID 118348546) has the molecular formula C10H18O8 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-[(2R,3S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid.
| Compound Name | 4-[(2R,3S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 118348546 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-[(2R,3S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanoic acid |
| SMILES | O=C(O)CCCO[C@@H]1OC(CO)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C10H18O8/c11-4-5-7(14)8(15)9(16)10(18-5)17-3-1-2-6(12)13/h5,7-11,14-16H,1-4H2,(H,12,13)/t5?,7-,8?,9-,10+/m0/s1 |
| InChIKey | PXBZEFNGRVXTJE-PEWSWKGSSA-N |
| XLogP | -2.33 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|