C9H18O6S — CID 118909583
(3S,4S,6S)-2-(hydroxymethyl)-6-(3-sulfanylpropoxy)oxane-3,4,5-triol (PubChem CID 118909583) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is (3S,4S,6S)-2-(hydroxymethyl)-6-(3-sulfanylpropoxy)oxane-3,4,5-triol.
| Compound Name | (3S,4S,6S)-2-(hydroxymethyl)-6-(3-sulfanylpropoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118909583 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (3S,4S,6S)-2-(hydroxymethyl)-6-(3-sulfanylpropoxy)oxane-3,4,5-triol |
| SMILES | OCC1O[C@H](OCCCS)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H18O6S/c10-4-5-6(11)7(12)8(13)9(15-5)14-2-1-3-16/h5-13,16H,1-4H2/t5?,6-,7+,8?,9+/m1/s1 |
| InChIKey | DHRYCMYGIMUHGV-IPVXCSAOSA-N |
| XLogP | -1.88 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|