C11H22O6S — CID 87575557
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(5-sulfanylpentoxy)oxane-3,4,5-triol (PubChem CID 87575557) has the molecular formula C11H22O6S and a molecular weight of 282.36 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(5-sulfanylpentoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(5-sulfanylpentoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 87575557 |
| Molecular Formula | C11H22O6S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(5-sulfanylpentoxy)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](OCCCCCS)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H22O6S/c12-6-7-8(13)9(14)10(15)11(17-7)16-4-2-1-3-5-18/h7-15,18H,1-6H2/t7-,8+,9+,10-,11+/m1/s1 |
| InChIKey | RVSGIPVVFBERPZ-KJPMQGKISA-N |
| XLogP | -1.10 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|