C11H22O5S — CID 59345749
2-(methoxymethyl)-5-(5-sulfanylpentoxy)oxolane-3,4-diol (PubChem CID 59345749) has the molecular formula C11H22O5S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-(methoxymethyl)-5-(5-sulfanylpentoxy)oxolane-3,4-diol.
| Compound Name | 2-(methoxymethyl)-5-(5-sulfanylpentoxy)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59345749 |
| Molecular Formula | C11H22O5S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(methoxymethyl)-5-(5-sulfanylpentoxy)oxolane-3,4-diol |
| SMILES | COCC1OC(OCCCCCS)C(O)C1O |
| InChI | InChI=1S/C11H22O5S/c1-14-7-8-9(12)10(13)11(16-8)15-5-3-2-4-6-17/h8-13,17H,2-7H2,1H3 |
| InChIKey | IOWQBANVRLVJAB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|