C22H43O14P — CID 162439633
4-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(5-methoxypentoxy)oxan-2-yl]methoxy]oxan-2-yl]methoxy]butoxyphosphinous acid (PubChem CID 162439633) has the molecular formula C22H43O14P and a molecular weight of 562.55 g/mol. Its IUPAC name is 4-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(5-methoxypentoxy)oxan-2-yl]methoxy]oxan-2-yl]methoxy]butoxyphosphinous acid.
| Compound Name | 4-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(5-methoxypentoxy)oxan-2-yl]methoxy]oxan-2-yl]methoxy]butoxyphosphinous acid |
|---|---|
| PubChem CID | 162439633 |
| Molecular Formula | C22H43O14P |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 4-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(5-methoxypentoxy)oxan-2-yl]methoxy]oxan-2-yl]methoxy]butoxyphosphinous acid |
| SMILES | COCCCCCOC1OC(COC2OC(COCCCCOPO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C22H43O14P/c1-30-7-3-2-4-9-32-21-19(27)18(26)16(24)14(36-21)12-33-22-20(28)17(25)15(23)13(35-22)11-31-8-5-6-10-34-37-29/h13-29,37H,2-12H2,1H3 |
| InChIKey | GPVWMFHLTMFGQG-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 206.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|