C19H36O9 — CID 11165716
(2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-octoxyoxolan-2-yl]methoxy]-5-(methoxymethyl)oxolane-3,4-diol (PubChem CID 11165716) has the molecular formula C19H36O9 and a molecular weight of 408.49 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-octoxyoxolan-2-yl]methoxy]-5-(methoxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-octoxyoxolan-2-yl]methoxy]-5-(methoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11165716 |
| Molecular Formula | C19H36O9 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-octoxyoxolan-2-yl]methoxy]-5-(methoxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCO[C@H]1O[C@H](CO[C@H]2O[C@H](COC)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H36O9/c1-3-4-5-6-7-8-9-25-18-16(22)15(21)13(28-18)11-26-19-17(23)14(20)12(27-19)10-24-2/h12-23H,3-11H2,1-2H3/t12-,13-,14-,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | IIFZTOWRBHKGTL-UYKRBRGISA-N |
| XLogP | -0.08 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|