C16H32O7 — CID 66765447
(2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-octoxyoxane-3,4,5-triol (PubChem CID 66765447) has the molecular formula C16H32O7 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-octoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-octoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 66765447 |
| Molecular Formula | C16H32O7 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(2-hydroxyethoxymethyl)-6-octoxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCO[C@H]1O[C@H](COCCO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H32O7/c1-2-3-4-5-6-7-9-22-16-15(20)14(19)13(18)12(23-16)11-21-10-8-17/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | UZBLLCYBHHPEDC-LJIZCISZSA-N |
| XLogP | 0.18 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|