C15H30O5S2 — CID 11187368
(2S,3S,4R,5S,6R)-2-methyl-6-[3-(6-sulfanylhexylsulfanyl)propoxy]oxane-3,4,5-triol (PubChem CID 11187368) has the molecular formula C15H30O5S2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-methyl-6-[3-(6-sulfanylhexylsulfanyl)propoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6R)-2-methyl-6-[3-(6-sulfanylhexylsulfanyl)propoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11187368 |
| Molecular Formula | C15H30O5S2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-methyl-6-[3-(6-sulfanylhexylsulfanyl)propoxy]oxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](OCCCSCCCCCCS)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H30O5S2/c1-11-12(16)13(17)14(18)15(20-11)19-7-6-10-22-9-5-3-2-4-8-21/h11-18,21H,2-10H2,1H3/t11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | TWHSZFVZTFTMRE-VYDRJRHOSA-N |
| XLogP | 1.44 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|