C11H22O5 — CID 153067799
(3S,6R)-2-methyl-6-(3-methylbutoxy)oxane-3,4,5-triol (PubChem CID 153067799) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3S,6R)-2-methyl-6-(3-methylbutoxy)oxane-3,4,5-triol.
| Compound Name | (3S,6R)-2-methyl-6-(3-methylbutoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 153067799 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (3S,6R)-2-methyl-6-(3-methylbutoxy)oxane-3,4,5-triol |
| SMILES | CC(C)CCO[C@@H]1OC(C)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C11H22O5/c1-6(2)4-5-15-11-10(14)9(13)8(12)7(3)16-11/h6-14H,4-5H2,1-3H3/t7?,8-,9?,10?,11-/m1/s1 |
| InChIKey | VKSPZZLQMCZGDN-PBPDKXIHSA-N |
| XLogP | -0.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |