C9H23NO5 — CID 158281712
(2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol;methane (PubChem CID 158281712) has the molecular formula C9H23NO5 and a molecular weight of 225.28 g/mol. Its IUPAC name is (2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol;methane.
| Compound Name | (2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol;methane |
|---|---|
| PubChem CID | 158281712 |
| Molecular Formula | C9H23NO5 |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol;methane |
| SMILES | C.C.CC1O[C@@H](OCN)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C7H15NO5.2CH4/c1-3-4(9)5(10)6(11)7(13-3)12-2-8;;/h3-7,9-11H,2,8H2,1H3;2*1H4/t3?,4-,5?,6-,7+;;/m0../s1 |
| InChIKey | GKHIDSDTCRTQCX-AWNRGRTQSA-N |
| XLogP | -0.98 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|