C8H15BrO5 — CID 129411527
(2R,3S,4R,5S,6S)-2-(2-bromoethoxy)-6-methyloxane-3,4,5-triol (PubChem CID 129411527) has the molecular formula C8H15BrO5 and a molecular weight of 271.11 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-(2-bromoethoxy)-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-2-(2-bromoethoxy)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 129411527 |
| Molecular Formula | C8H15BrO5 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-(2-bromoethoxy)-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](OCCBr)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H15BrO5/c1-4-5(10)6(11)7(12)8(14-4)13-3-2-9/h4-8,10-12H,2-3H2,1H3/t4-,5+,6+,7-,8+/m0/s1 |
| InChIKey | DWUSABAMFRKIEV-FMGWEMOISA-N |
| XLogP | -0.77 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|