C11H20O5 — CID 121217017
(2R,3R,4S,5R)-2-methyl-6-pent-4-enoxyoxane-3,4,5-triol (PubChem CID 121217017) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-methyl-6-pent-4-enoxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-methyl-6-pent-4-enoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 121217017 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-methyl-6-pent-4-enoxyoxane-3,4,5-triol |
| SMILES | C=CCCCOC1O[C@H](C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O5/c1-3-4-5-6-15-11-10(14)9(13)8(12)7(2)16-11/h3,7-14H,1,4-6H2,2H3/t7-,8+,9+,10-,11?/m1/s1 |
| InChIKey | MCCANGQJXWVIBN-FNIJGJLWSA-N |
| XLogP | -0.20 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|