C7H15NO5 — CID 90276853
(2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol (PubChem CID 90276853) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 90276853 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (2S,3S,5R)-2-(aminomethoxy)-6-methyloxane-3,4,5-triol |
| SMILES | CC1O[C@@H](OCN)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C7H15NO5/c1-3-4(9)5(10)6(11)7(13-3)12-2-8/h3-7,9-11H,2,8H2,1H3/t3?,4-,5?,6-,7+/m0/s1 |
| InChIKey | SHAVEORDJDSUEB-CTLJMDONSA-N |
| XLogP | -2.25 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|