C18H28O7 — CID 175108456
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-methoxy-5-phenylpentoxy)oxane-3,4,5-triol (PubChem CID 175108456) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-methoxy-5-phenylpentoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-methoxy-5-phenylpentoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 175108456 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(1-methoxy-5-phenylpentoxy)oxane-3,4,5-triol |
| SMILES | COC(CCCCc1ccccc1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H28O7/c1-23-14(10-6-5-9-12-7-3-2-4-8-12)25-18-17(22)16(21)15(20)13(11-19)24-18/h2-4,7-8,13-22H,5-6,9-11H2,1H3/t13-,14?,15-,16+,17-,18+/m1/s1 |
| InChIKey | DJLHBRARXYIRSS-XHLLLEBJSA-N |
| XLogP | 0.19 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|