C30H42O12 — CID 86279471
(2R,3R,4S,5S,6R)-2-[(3R)-1,7-bis(4-hydroxyphenyl)heptan-3-yl]oxy-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 86279471) has the molecular formula C30H42O12 and a molecular weight of 594.65 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3R)-1,7-bis(4-hydroxyphenyl)heptan-3-yl]oxy-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(3R)-1,7-bis(4-hydroxyphenyl)heptan-3-yl]oxy-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 86279471 |
| Molecular Formula | C30H42O12 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3R)-1,7-bis(4-hydroxyphenyl)heptan-3-yl]oxy-6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](OC[C@H]2O[C@@H](O[C@H](CCCCc3ccc(O)cc3)CCc3ccc(O)cc3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H42O12/c31-15-22-24(34)27(37)29(41-22)39-16-23-25(35)26(36)28(38)30(42-23)40-21(14-9-18-7-12-20(33)13-8-18)4-2-1-3-17-5-10-19(32)11-6-17/h5-8,10-13,21-38H,1-4,9,14-16H2/t21-,22+,23-,24+,25-,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | GEZFOHOYLWPGPK-SJPFRHABSA-N |
| XLogP | 0.09 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|