C19H29NO6 — CID 102065434
N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-phenylpentoxy)oxan-3-yl]acetamide (PubChem CID 102065434) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-phenylpentoxy)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-phenylpentoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 102065434 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-phenylpentoxy)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCCCc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H29NO6/c1-13(22)20-16-18(24)17(23)15(12-21)26-19(16)25-11-7-3-6-10-14-8-4-2-5-9-14/h2,4-5,8-9,15-19,21,23-24H,3,6-7,10-12H2,1H3,(H,20,22)/t15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | XTQWPCWLYLYGBM-FVVUREQNSA-N |
| XLogP | 0.36 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|