C13H25NO6S — CID 88953091
N-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-sulfanylpentoxy)oxan-3-yl]acetamide (PubChem CID 88953091) has the molecular formula C13H25NO6S and a molecular weight of 323.41 g/mol. Its IUPAC name is N-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-sulfanylpentoxy)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-sulfanylpentoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 88953091 |
| Molecular Formula | C13H25NO6S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-(5-sulfanylpentoxy)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1[C@H](OCCCCCS)OC(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H25NO6S/c1-8(16)14-10-12(18)11(17)9(7-15)20-13(10)19-5-3-2-4-6-21/h9-13,15,17-18,21H,2-7H2,1H3,(H,14,16)/t9?,10?,11-,12-,13-/m1/s1 |
| InChIKey | BDQDUTNGAPWVMU-RKJHCZSYSA-N |
| XLogP | -0.95 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|