C19H35NO8 — CID 54189846
ethyl 9-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate (PubChem CID 54189846) has the molecular formula C19H35NO8 and a molecular weight of 405.49 g/mol. Its IUPAC name is ethyl 9-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate.
| Compound Name | ethyl 9-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate |
|---|---|
| PubChem CID | 54189846 |
| Molecular Formula | C19H35NO8 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethyl 9-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynonanoate |
| SMILES | CCOC(=O)CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C19H35NO8/c1-3-26-15(23)10-8-6-4-5-7-9-11-27-19-16(20-13(2)22)18(25)17(24)14(12-21)28-19/h14,16-19,21,24-25H,3-12H2,1-2H3,(H,20,22)/t14-,16-,17-,18-,19-/m1/s1 |
| InChIKey | PHSYRKVTVRCLAD-WSIUPNEHSA-N |
| XLogP | 0.24 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|