C15H28N2O7S — CID 91464782
N-[3-[(3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-4-sulfanylbutanamide (PubChem CID 91464782) has the molecular formula C15H28N2O7S and a molecular weight of 380.46 g/mol. Its IUPAC name is N-[3-[(3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-4-sulfanylbutanamide.
| Compound Name | N-[3-[(3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-4-sulfanylbutanamide |
|---|---|
| PubChem CID | 91464782 |
| Molecular Formula | C15H28N2O7S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[3-[(3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-4-sulfanylbutanamide |
| SMILES | CC(=O)N[C@H]1C(OCCCNC(=O)CCCS)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H28N2O7S/c1-9(19)17-12-14(22)13(21)10(8-18)24-15(12)23-6-3-5-16-11(20)4-2-7-25/h10,12-15,18,21-22,25H,2-8H2,1H3,(H,16,20)(H,17,19)/t10-,12-,13-,14-,15?/m1/s1 |
| InChIKey | JZOWRNIRRQACGN-RKHBJWJHSA-N |
| XLogP | -1.84 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|