C22H42N2O8 — CID 164838795
N-[6-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]-3-(2,2-dimethylpropoxy)propanamide (PubChem CID 164838795) has the molecular formula C22H42N2O8 and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[6-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]-3-(2,2-dimethylpropoxy)propanamide.
| Compound Name | N-[6-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]-3-(2,2-dimethylpropoxy)propanamide |
|---|---|
| PubChem CID | 164838795 |
| Molecular Formula | C22H42N2O8 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | N-[6-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]-3-(2,2-dimethylpropoxy)propanamide |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCCCCNC(=O)CCOCC(C)(C)C)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H42N2O8/c1-15(26)24-18-20(29)19(28)16(13-25)32-21(18)31-11-8-6-5-7-10-23-17(27)9-12-30-14-22(2,3)4/h16,18-21,25,28-29H,5-14H2,1-4H3,(H,23,27)(H,24,26)/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KARJNRQCXGHEAR-QNDFHXLGSA-N |
| XLogP | 0.08 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|