C20H39N3O9 — CID 146589143
N-[5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]-3-[2-(2-aminoethoxy)ethoxy]propanamide (PubChem CID 146589143) has the molecular formula C20H39N3O9 and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]-3-[2-(2-aminoethoxy)ethoxy]propanamide.
| Compound Name | N-[5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]-3-[2-(2-aminoethoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 146589143 |
| Molecular Formula | C20H39N3O9 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | N-[5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]-3-[2-(2-aminoethoxy)ethoxy]propanamide |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCCCNC(=O)CCOCCOCCN)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H39N3O9/c1-14(25)23-17-19(28)18(27)15(13-24)32-20(17)31-8-4-2-3-7-22-16(26)5-9-29-11-12-30-10-6-21/h15,17-20,24,27-28H,2-13,21H2,1H3,(H,22,26)(H,23,25)/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | VNTQEHYFQWWJFH-XIKSMUEASA-N |
| XLogP | -2.38 |
| TPSA | 181.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|