C23H44N2O10 — CID 118408549
2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-N-heptylacetamide (PubChem CID 118408549) has the molecular formula C23H44N2O10 and a molecular weight of 508.61 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-N-heptylacetamide.
| Compound Name | 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-N-heptylacetamide |
|---|---|
| PubChem CID | 118408549 |
| Molecular Formula | C23H44N2O10 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]-N-heptylacetamide |
| SMILES | CCCCCCCNC(=O)COCCOCCOCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C23H44N2O10/c1-3-4-5-6-7-8-24-19(28)16-33-12-11-31-9-10-32-13-14-34-23-20(25-17(2)27)22(30)21(29)18(15-26)35-23/h18,20-23,26,29-30H,3-16H2,1-2H3,(H,24,28)(H,25,27)/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | ZRPLJJCFAINEPY-DODNOZFWSA-N |
| XLogP | -0.92 |
| TPSA | 165.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|