C21H40N2O11 — CID 171593259
N-[2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]-3-ethoxypropanamide (PubChem CID 171593259) has the molecular formula C21H40N2O11 and a molecular weight of 496.55 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]-3-ethoxypropanamide.
| Compound Name | N-[2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]-3-ethoxypropanamide |
|---|---|
| PubChem CID | 171593259 |
| Molecular Formula | C21H40N2O11 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-[2-[2-[2-[2-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)NCCOCCOCCOCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C21H40N2O11/c1-3-29-6-4-17(26)22-5-7-30-8-9-31-10-11-32-12-13-33-21-18(23-15(2)25)20(28)19(27)16(14-24)34-21/h16,18-21,24,27-28H,3-14H2,1-2H3,(H,22,26)(H,23,25)/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | OYVCDFVQYIZFOS-QNDFHXLGSA-N |
| XLogP | -2.46 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|