C26H49N3O13 — CID 118535952
tert-butyl N-[2-[2-[2-[2-[3-[2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 118535952) has the molecular formula C26H49N3O13 and a molecular weight of 611.69 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[3-[2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[3-[2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 118535952 |
| Molecular Formula | C26H49N3O13 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[3-[2-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCNC(=O)CCOCCOCCOCCOCCNC(=O)OC(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H49N3O13/c1-18(31)29-21-23(34)22(33)19(17-30)41-24(21)40-10-7-27-20(32)5-8-36-11-13-38-15-16-39-14-12-37-9-6-28-25(35)42-26(2,3)4/h19,21-24,30,33-34H,5-17H2,1-4H3,(H,27,32)(H,28,35)(H,29,31)/t19-,21-,22-,23-,24-/m1/s1 |
| InChIKey | UBRHCNHCZJTAPP-JTYPQFNSSA-N |
| XLogP | -1.96 |
| TPSA | 212.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|