C16H30N2O7 — CID 162475803
N-[2-[(3S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3,3-dimethylbutanamide (PubChem CID 162475803) has the molecular formula C16H30N2O7 and a molecular weight of 362.42 g/mol. Its IUPAC name is N-[2-[(3S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-[(3S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 162475803 |
| Molecular Formula | C16H30N2O7 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-[2-[(3S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3,3-dimethylbutanamide |
| SMILES | CC(=O)N[C@@H]1C(OCCNC(=O)CC(C)(C)C)OC(CO)[C@@H](O)C1O |
| InChI | InChI=1S/C16H30N2O7/c1-9(20)18-12-14(23)13(22)10(8-19)25-15(12)24-6-5-17-11(21)7-16(2,3)4/h10,12-15,19,22-23H,5-8H2,1-4H3,(H,17,21)(H,18,20)/t10?,12-,13+,14?,15?/m0/s1 |
| InChIKey | FYIVTTVQKSEIEV-VOFOUSNASA-N |
| XLogP | -1.50 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|