C13H21F3N2O7 — CID 101205167
N-[3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,2,2-trifluoroacetamide (PubChem CID 101205167) has the molecular formula C13H21F3N2O7 and a molecular weight of 374.31 g/mol. Its IUPAC name is N-[3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101205167 |
| Molecular Formula | C13H21F3N2O7 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](OCCCNC(=O)C(F)(F)F)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H21F3N2O7/c1-6(20)18-8-10(22)9(21)7(5-19)25-11(8)24-4-2-3-17-12(23)13(14,15)16/h7-11,19,21-22H,2-5H2,1H3,(H,17,23)(H,18,20)/t7-,8-,9+,10-,11+/m1/s1 |
| InChIKey | PMGBPPBZXKSUBY-NZFPMDFQSA-N |
| XLogP | -1.98 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|