C15H22F3NO9 — CID 101205164
[(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxan-4-yl] acetate (PubChem CID 101205164) has the molecular formula C15H22F3NO9 and a molecular weight of 417.33 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 101205164 |
| Molecular Formula | C15H22F3NO9 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OCCCNC(=O)C(F)(F)F)O[C@H](CO)[C@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H22F3NO9/c1-7(21)26-11-10(23)9(6-20)28-13(12(11)27-8(2)22)25-5-3-4-19-14(24)15(16,17)18/h9-13,20,23H,3-6H2,1-2H3,(H,19,24)/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | VSPZXRHRRBNIAZ-KSSYENDESA-N |
| XLogP | -0.99 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|