C18H25N2O9P+2 — CID 132548372
[azaniumyloxy-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-phenylphenoxy)oxan-3-yl]oxyphosphoryl]oxyazanium (PubChem CID 132548372) has the molecular formula C18H25N2O9P+2 and a molecular weight of 444.38 g/mol. Its IUPAC name is [azaniumyloxy-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-phenylphenoxy)oxan-3-yl]oxyphosphoryl]oxyazanium.
| Compound Name | [azaniumyloxy-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-phenylphenoxy)oxan-3-yl]oxyphosphoryl]oxyazanium |
|---|---|
| PubChem CID | 132548372 |
| Molecular Formula | C18H25N2O9P+2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [azaniumyloxy-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-phenylphenoxy)oxan-3-yl]oxyphosphoryl]oxyazanium |
| SMILES | [NH3+]OP(=O)(O[NH3+])O[C@H]1[C@H](O)[C@H](O)[C@@H](Oc2ccc(-c3ccccc3)cc2)O[C@@H]1CO |
| InChI | InChI=1S/C18H25N2O9P/c19-28-30(24,29-20)27-17-14(10-21)26-18(16(23)15(17)22)25-13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14-18,21-23H,10H2,19-20H3/q+2/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | DODAQHYDYTXGLA-SFFUCWETSA-N |
| XLogP | -0.99 |
| TPSA | 179.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|