C19H27N2O10P — CID 168749712
[(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamoylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate (PubChem CID 168749712) has the molecular formula C19H27N2O10P and a molecular weight of 474.40 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamoylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamoylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 168749712 |
| Molecular Formula | C19H27N2O10P |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-6-[4-(hex-5-ynylcarbamoylamino)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate |
| SMILES | C#CCCCCNC(=O)Nc1ccc(O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H27N2O10P/c1-2-3-4-5-10-20-19(25)21-12-6-8-13(9-7-12)30-18-17(24)16(23)15(22)14(31-18)11-29-32(26,27)28/h1,6-9,14-18,22-24H,3-5,10-11H2,(H2,20,21,25)(H2,26,27,28)/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | KVEYMBUCAZASAR-ZBRFXRBCSA-N |
| XLogP | -0.09 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|